C34H50O6Si2 — CID 59165100
2,10-bis[[tert-butyl(dimethyl)silyl]oxy]-1,2,3,4,4a,7a,8,9,10,11,11a,14a-dodecahydropentacene-5,7,12,14-tetrone (PubChem CID 59165100) has the molecular formula C34H50O6Si2 and a molecular weight of 610.94 g/mol. Its IUPAC name is 2,10-bis[[tert-butyl(dimethyl)silyl]oxy]-1,2,3,4,4a,7a,8,9,10,11,11a,14a-dodecahydropentacene-5,7,12,14-tetrone.
| Compound Name | 2,10-bis[[tert-butyl(dimethyl)silyl]oxy]-1,2,3,4,4a,7a,8,9,10,11,11a,14a-dodecahydropentacene-5,7,12,14-tetrone |
|---|---|
| PubChem CID | 59165100 |
| Molecular Formula | C34H50O6Si2 |
| Molecular Weight | 610.94 g/mol |
| Exact Mass | 610.31 |
| IUPAC Name | 2,10-bis[[tert-butyl(dimethyl)silyl]oxy]-1,2,3,4,4a,7a,8,9,10,11,11a,14a-dodecahydropentacene-5,7,12,14-tetrone |
| SMILES | CC(C)(C)[Si](C)(C)OC1CCC2C(=O)c3cc4c(cc3C(=O)C2C1)C(=O)C1CC(O[Si](C)(C)C(C)(C)C)CCC1C4=O |
| InChI | InChI=1S/C34H50O6Si2/c1-33(2,3)41(7,8)39-19-11-13-21-23(15-19)31(37)27-18-28-26(17-25(27)29(21)35)30(36)22-14-12-20(16-24(22)32(28)38)40-42(9,10)34(4,5)6/h17-24H,11-16H2,1-10H3 |
| InChIKey | ZLRRRQHFFRVQEV-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.94 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|