About chromium;(Z)-4-hydroxypent-3-en-2-one;2-pyridin-2-ylpyridine
chromium;(Z)-4-hydroxypent-3-en-2-one;2-pyridin-2-ylpyridine (PubChem CID 59165144) has the molecular formula C15H16CrN2O2
and a molecular weight of 308.30 g/mol. Its IUPAC name is chromium;(Z)-4-hydroxypent-3-en-2-one;2-pyridin-2-ylpyridine.
Molecular Properties
| Compound Name | chromium;(Z)-4-hydroxypent-3-en-2-one;2-pyridin-2-ylpyridine |
| PubChem CID | 59165144 |
| Molecular Formula | C15H16CrN2O2 |
| Molecular Weight | 308.30 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | chromium;(Z)-4-hydroxypent-3-en-2-one;2-pyridin-2-ylpyridine |
| SMILES | CC(=O)/C=C(/C)O.[Cr].c1ccc(-c2ccccn2)nc1 |
| InChI | InChI=1S/C10H8N2.C5H8O2.Cr/c1-3-7-11-9(5-1)10-6-2-4-8-12-10;1-4(6)3-5(2)7;/h1-8H;3,6H,1-2H3;/b;4-3-; |
| InChIKey | OAFRLRKBHMGNQK-LWFKIUJUSA-N |
| XLogP | 3.18 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.30 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze chromium;(Z)-4-hydroxypent-3-en-2-one;2-pyridin-2-ylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chromium;(Z)-4-hydroxypent-3-en-2-one;2-pyridin-2-ylpyridine?
The IUPAC name of chromium;(Z)-4-hydroxypent-3-en-2-one;2-pyridin-2-ylpyridine (CID 59165144) is chromium;(Z)-4-hydroxypent-3-en-2-one;2-pyridin-2-ylpyridine.
What is the SMILES notation for chromium;(Z)-4-hydroxypent-3-en-2-one;2-pyridin-2-ylpyridine?
The canonical SMILES for chromium;(Z)-4-hydroxypent-3-en-2-one;2-pyridin-2-ylpyridine is CC(=O)/C=C(/C)O.[Cr].c1ccc(-c2ccccn2)nc1.
What is the InChIKey of chromium;(Z)-4-hydroxypent-3-en-2-one;2-pyridin-2-ylpyridine?
The InChIKey is OAFRLRKBHMGNQK-LWFKIUJUSA-N. The full InChI is InChI=1S/C10H8N2.C5H8O2.Cr/c1-3-7-11-9(5-1)10-6-2-4-8-12-10;1-4(6)3-5(2)7;/h1-8H;3,6H,1-2H3;/b;4-3-;.
What are the key properties of chromium;(Z)-4-hydroxypent-3-en-2-one;2-pyridin-2-ylpyridine?
chromium;(Z)-4-hydroxypent-3-en-2-one;2-pyridin-2-ylpyridine has a molecular weight of 308.30 g/mol, XLogP of 3.18, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for chromium;(Z)-4-hydroxypent-3-en-2-one;2-pyridin-2-ylpyridine is sourced from PubChem (CID 59165144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).