C14H17F2N3O3S — CID 59165293
2-[5-(2,4-difluorophenyl)-3-propyl-1,2,4-triazol-1-yl]ethyl methanesulfonate (PubChem CID 59165293) has the molecular formula C14H17F2N3O3S and a molecular weight of 345.37 g/mol. Its IUPAC name is 2-[5-(2,4-difluorophenyl)-3-propyl-1,2,4-triazol-1-yl]ethyl methanesulfonate.
| Compound Name | 2-[5-(2,4-difluorophenyl)-3-propyl-1,2,4-triazol-1-yl]ethyl methanesulfonate |
|---|---|
| PubChem CID | 59165293 |
| Molecular Formula | C14H17F2N3O3S |
| Molecular Weight | 345.37 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | 2-[5-(2,4-difluorophenyl)-3-propyl-1,2,4-triazol-1-yl]ethyl methanesulfonate |
| SMILES | CCCc1nc(-c2ccc(F)cc2F)n(CCOS(C)(=O)=O)n1 |
| InChI | InChI=1S/C14H17F2N3O3S/c1-3-4-13-17-14(11-6-5-10(15)9-12(11)16)19(18-13)7-8-22-23(2,20)21/h5-6,9H,3-4,7-8H2,1-2H3 |
| InChIKey | AKDRIOGQACSITL-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.37 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|