C13H15F2N3O — CID 59165295
2-[5-(2,4-difluorophenyl)-3-propyl-1,2,4-triazol-1-yl]ethanol (PubChem CID 59165295) has the molecular formula C13H15F2N3O and a molecular weight of 267.28 g/mol. Its IUPAC name is 2-[5-(2,4-difluorophenyl)-3-propyl-1,2,4-triazol-1-yl]ethanol.
| Compound Name | 2-[5-(2,4-difluorophenyl)-3-propyl-1,2,4-triazol-1-yl]ethanol |
|---|---|
| PubChem CID | 59165295 |
| Molecular Formula | C13H15F2N3O |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | 2-[5-(2,4-difluorophenyl)-3-propyl-1,2,4-triazol-1-yl]ethanol |
| SMILES | CCCc1nc(-c2ccc(F)cc2F)n(CCO)n1 |
| InChI | InChI=1S/C13H15F2N3O/c1-2-3-12-16-13(18(17-12)6-7-19)10-5-4-9(14)8-11(10)15/h4-5,8,19H,2-3,6-7H2,1H3 |
| InChIKey | AQXNUPXQJJUXAY-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |