About 3,5-diethylpyridin-4-amine
3,5-diethylpyridin-4-amine (PubChem CID 591654) has the molecular formula C9H14N2
and a molecular weight of 150.22 g/mol. Its IUPAC name is 3,5-diethylpyridin-4-amine.
Molecular Properties
| Compound Name | 3,5-diethylpyridin-4-amine |
| PubChem CID | 591654 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | 3,5-diethylpyridin-4-amine |
| SMILES | CCc1cncc(CC)c1N |
| InChI | InChI=1S/C9H14N2/c1-3-7-5-11-6-8(4-2)9(7)10/h5-6H,3-4H2,1-2H3,(H2,10,11) |
| InChIKey | LMTLGALYQURORH-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,5-diethylpyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-diethylpyridin-4-amine?
The IUPAC name of 3,5-diethylpyridin-4-amine (CID 591654) is 3,5-diethylpyridin-4-amine.
What is the SMILES notation for 3,5-diethylpyridin-4-amine?
The canonical SMILES for 3,5-diethylpyridin-4-amine is CCc1cncc(CC)c1N.
What is the InChIKey of 3,5-diethylpyridin-4-amine?
The InChIKey is LMTLGALYQURORH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2/c1-3-7-5-11-6-8(4-2)9(7)10/h5-6H,3-4H2,1-2H3,(H2,10,11).
What are the key properties of 3,5-diethylpyridin-4-amine?
3,5-diethylpyridin-4-amine has a molecular weight of 150.22 g/mol, XLogP of 1.79, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-diethylpyridin-4-amine is sourced from PubChem (CID 591654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).