C18H15ClF2N2O3 — CID 59165835
N-(6-chloro-5-ethyl-2-pyridinyl)-1-(2,2-difluoro-1,3-benzodioxol-5-yl)cyclopropane-1-carboxamide (PubChem CID 59165835) has the molecular formula C18H15ClF2N2O3 and a molecular weight of 380.78 g/mol. Its IUPAC name is N-(6-chloro-5-ethyl-2-pyridinyl)-1-(2,2-difluoro-1,3-benzodioxol-5-yl)cyclopropane-1-carboxamide.
| Compound Name | N-(6-chloro-5-ethyl-2-pyridinyl)-1-(2,2-difluoro-1,3-benzodioxol-5-yl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 59165835 |
| Molecular Formula | C18H15ClF2N2O3 |
| Molecular Weight | 380.78 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | N-(6-chloro-5-ethyl-2-pyridinyl)-1-(2,2-difluoro-1,3-benzodioxol-5-yl)cyclopropane-1-carboxamide |
| SMILES | CCc1ccc(NC(=O)C2(c3ccc4c(c3)OC(F)(F)O4)CC2)nc1Cl |
| InChI | InChI=1S/C18H15ClF2N2O3/c1-2-10-3-6-14(22-15(10)19)23-16(24)17(7-8-17)11-4-5-12-13(9-11)26-18(20,21)25-12/h3-6,9H,2,7-8H2,1H3,(H,22,23,24) |
| InChIKey | RDMWAASADSFTHB-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.78 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|