C17H13BrF2N2O4 — CID 59165869
N-(6-bromo-5-methoxy-2-pyridinyl)-1-(2,2-difluoro-1,3-benzodioxol-5-yl)cyclopropane-1-carboxamide (PubChem CID 59165869) has the molecular formula C17H13BrF2N2O4 and a molecular weight of 427.20 g/mol. Its IUPAC name is N-(6-bromo-5-methoxy-2-pyridinyl)-1-(2,2-difluoro-1,3-benzodioxol-5-yl)cyclopropane-1-carboxamide.
| Compound Name | N-(6-bromo-5-methoxy-2-pyridinyl)-1-(2,2-difluoro-1,3-benzodioxol-5-yl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 59165869 |
| Molecular Formula | C17H13BrF2N2O4 |
| Molecular Weight | 427.20 g/mol |
| Exact Mass | 426.00 |
| IUPAC Name | N-(6-bromo-5-methoxy-2-pyridinyl)-1-(2,2-difluoro-1,3-benzodioxol-5-yl)cyclopropane-1-carboxamide |
| SMILES | COc1ccc(NC(=O)C2(c3ccc4c(c3)OC(F)(F)O4)CC2)nc1Br |
| InChI | InChI=1S/C17H13BrF2N2O4/c1-24-11-4-5-13(21-14(11)18)22-15(23)16(6-7-16)9-2-3-10-12(8-9)26-17(19,20)25-10/h2-5,8H,6-7H2,1H3,(H,21,22,23) |
| InChIKey | IOYXYEPBEDKOLA-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.20 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|