About 1-[(1S)-3,3-difluorocyclopentyl]-4-propan-2-ylbenzene
1-[(1S)-3,3-difluorocyclopentyl]-4-propan-2-ylbenzene (PubChem CID 59166669) has the molecular formula C14H18F2
and a molecular weight of 224.29 g/mol. Its IUPAC name is 1-[(1S)-3,3-difluorocyclopentyl]-4-propan-2-ylbenzene.
Molecular Properties
| Compound Name | 1-[(1S)-3,3-difluorocyclopentyl]-4-propan-2-ylbenzene |
| PubChem CID | 59166669 |
| Molecular Formula | C14H18F2 |
| Molecular Weight | 224.29 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | 1-[(1S)-3,3-difluorocyclopentyl]-4-propan-2-ylbenzene |
| SMILES | CC(C)c1ccc([C@H]2CCC(F)(F)C2)cc1 |
| InChI | InChI=1S/C14H18F2/c1-10(2)11-3-5-12(6-4-11)13-7-8-14(15,16)9-13/h3-6,10,13H,7-9H2,1-2H3/t13-/m0/s1 |
| InChIKey | YPIZIXJOMPJUAF-ZDUSSCGKSA-N |
| XLogP | 4.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.29 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-[(1S)-3,3-difluorocyclopentyl]-4-propan-2-ylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1S)-3,3-difluorocyclopentyl]-4-propan-2-ylbenzene?
The IUPAC name of 1-[(1S)-3,3-difluorocyclopentyl]-4-propan-2-ylbenzene (CID 59166669) is 1-[(1S)-3,3-difluorocyclopentyl]-4-propan-2-ylbenzene.
What is the SMILES notation for 1-[(1S)-3,3-difluorocyclopentyl]-4-propan-2-ylbenzene?
The canonical SMILES for 1-[(1S)-3,3-difluorocyclopentyl]-4-propan-2-ylbenzene is CC(C)c1ccc([C@H]2CCC(F)(F)C2)cc1.
What is the InChIKey of 1-[(1S)-3,3-difluorocyclopentyl]-4-propan-2-ylbenzene?
The InChIKey is YPIZIXJOMPJUAF-ZDUSSCGKSA-N. The full InChI is InChI=1S/C14H18F2/c1-10(2)11-3-5-12(6-4-11)13-7-8-14(15,16)9-13/h3-6,10,13H,7-9H2,1-2H3/t13-/m0/s1.
What are the key properties of 1-[(1S)-3,3-difluorocyclopentyl]-4-propan-2-ylbenzene?
1-[(1S)-3,3-difluorocyclopentyl]-4-propan-2-ylbenzene has a molecular weight of 224.29 g/mol, XLogP of 4.71, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1S)-3,3-difluorocyclopentyl]-4-propan-2-ylbenzene is sourced from PubChem (CID 59166669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).