C21H29N3O3 — CID 59167048
tert-butyl N-[3-hydroxy-1-phenyl-4-(pyridin-2-ylmethylamino)butan-2-yl]carbamate (PubChem CID 59167048) has the molecular formula C21H29N3O3 and a molecular weight of 371.48 g/mol. Its IUPAC name is tert-butyl N-[3-hydroxy-1-phenyl-4-(pyridin-2-ylmethylamino)butan-2-yl]carbamate.
| Compound Name | tert-butyl N-[3-hydroxy-1-phenyl-4-(pyridin-2-ylmethylamino)butan-2-yl]carbamate |
|---|---|
| PubChem CID | 59167048 |
| Molecular Formula | C21H29N3O3 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.22 |
| IUPAC Name | tert-butyl N-[3-hydroxy-1-phenyl-4-(pyridin-2-ylmethylamino)butan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(Cc1ccccc1)C(O)CNCc1ccccn1 |
| InChI | InChI=1S/C21H29N3O3/c1-21(2,3)27-20(26)24-18(13-16-9-5-4-6-10-16)19(25)15-22-14-17-11-7-8-12-23-17/h4-12,18-19,22,25H,13-15H2,1-3H3,(H,24,26) |
| InChIKey | JIQLOMNFCOSXFZ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |