About 3,5-bis(2,4-dimethylphenyl)-2-(4-methylphenyl)thiophene
3,5-bis(2,4-dimethylphenyl)-2-(4-methylphenyl)thiophene (PubChem CID 59167085) has the molecular formula C27H26S
and a molecular weight of 382.57 g/mol. Its IUPAC name is 3,5-bis(2,4-dimethylphenyl)-2-(4-methylphenyl)thiophene.
Molecular Properties
| Compound Name | 3,5-bis(2,4-dimethylphenyl)-2-(4-methylphenyl)thiophene |
| PubChem CID | 59167085 |
| Molecular Formula | C27H26S |
| Molecular Weight | 382.57 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | 3,5-bis(2,4-dimethylphenyl)-2-(4-methylphenyl)thiophene |
| SMILES | Cc1ccc(-c2sc(-c3ccc(C)cc3C)cc2-c2ccc(C)cc2C)cc1 |
| InChI | InChI=1S/C27H26S/c1-17-6-10-22(11-7-17)27-25(23-12-8-18(2)14-20(23)4)16-26(28-27)24-13-9-19(3)15-21(24)5/h6-16H,1-5H3 |
| InChIKey | VKPAMJFXYMAXAU-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 382.57 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,5-bis(2,4-dimethylphenyl)-2-(4-methylphenyl)thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-bis(2,4-dimethylphenyl)-2-(4-methylphenyl)thiophene?
The IUPAC name of 3,5-bis(2,4-dimethylphenyl)-2-(4-methylphenyl)thiophene (CID 59167085) is 3,5-bis(2,4-dimethylphenyl)-2-(4-methylphenyl)thiophene.
What is the SMILES notation for 3,5-bis(2,4-dimethylphenyl)-2-(4-methylphenyl)thiophene?
The canonical SMILES for 3,5-bis(2,4-dimethylphenyl)-2-(4-methylphenyl)thiophene is Cc1ccc(-c2sc(-c3ccc(C)cc3C)cc2-c2ccc(C)cc2C)cc1.
What is the InChIKey of 3,5-bis(2,4-dimethylphenyl)-2-(4-methylphenyl)thiophene?
The InChIKey is VKPAMJFXYMAXAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H26S/c1-17-6-10-22(11-7-17)27-25(23-12-8-18(2)14-20(23)4)16-26(28-27)24-13-9-19(3)15-21(24)5/h6-16H,1-5H3.
What are the key properties of 3,5-bis(2,4-dimethylphenyl)-2-(4-methylphenyl)thiophene?
3,5-bis(2,4-dimethylphenyl)-2-(4-methylphenyl)thiophene has a molecular weight of 382.57 g/mol, XLogP of 8.29, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-bis(2,4-dimethylphenyl)-2-(4-methylphenyl)thiophene is sourced from PubChem (CID 59167085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).