About (3-methoxy-2-oxopropyl) acetate
(3-methoxy-2-oxopropyl) acetate (PubChem CID 59167143) has the molecular formula C6H10O4
and a molecular weight of 146.14 g/mol. Its IUPAC name is (3-methoxy-2-oxopropyl) acetate.
Molecular Properties
| Compound Name | (3-methoxy-2-oxopropyl) acetate |
| PubChem CID | 59167143 |
| Molecular Formula | C6H10O4 |
| Molecular Weight | 146.14 g/mol |
| Exact Mass | 146.06 |
| IUPAC Name | (3-methoxy-2-oxopropyl) acetate |
| SMILES | COCC(=O)COC(C)=O |
| InChI | InChI=1S/C6H10O4/c1-5(7)10-4-6(8)3-9-2/h3-4H2,1-2H3 |
| InChIKey | AZSJNKDEHJMIPZ-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.14 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3-methoxy-2-oxopropyl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methoxy-2-oxopropyl) acetate?
The IUPAC name of (3-methoxy-2-oxopropyl) acetate (CID 59167143) is (3-methoxy-2-oxopropyl) acetate.
What is the SMILES notation for (3-methoxy-2-oxopropyl) acetate?
The canonical SMILES for (3-methoxy-2-oxopropyl) acetate is COCC(=O)COC(C)=O.
What is the InChIKey of (3-methoxy-2-oxopropyl) acetate?
The InChIKey is AZSJNKDEHJMIPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O4/c1-5(7)10-4-6(8)3-9-2/h3-4H2,1-2H3.
What are the key properties of (3-methoxy-2-oxopropyl) acetate?
(3-methoxy-2-oxopropyl) acetate has a molecular weight of 146.14 g/mol, XLogP of -0.23, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methoxy-2-oxopropyl) acetate is sourced from PubChem (CID 59167143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).