About 9-methoxy-3,8-dimethyl-2-phenoxybenzo[c][1,2]benzodithiine
9-methoxy-3,8-dimethyl-2-phenoxybenzo[c][1,2]benzodithiine (PubChem CID 59167349) has the molecular formula C21H18O2S2
and a molecular weight of 366.51 g/mol. Its IUPAC name is 9-methoxy-3,8-dimethyl-2-phenoxybenzo[c][1,2]benzodithiine.
Molecular Properties
| Compound Name | 9-methoxy-3,8-dimethyl-2-phenoxybenzo[c][1,2]benzodithiine |
| PubChem CID | 59167349 |
| Molecular Formula | C21H18O2S2 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | 9-methoxy-3,8-dimethyl-2-phenoxybenzo[c][1,2]benzodithiine |
| SMILES | COc1cc2c(cc1C)SSc1cc(C)c(Oc3ccccc3)cc1-2 |
| InChI | InChI=1S/C21H18O2S2/c1-13-9-20-16(11-18(13)22-3)17-12-19(14(2)10-21(17)25-24-20)23-15-7-5-4-6-8-15/h4-12H,1-3H3 |
| InChIKey | QAUUAZHBPPRKJY-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|
Analyze 9-methoxy-3,8-dimethyl-2-phenoxybenzo[c][1,2]benzodithiine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-methoxy-3,8-dimethyl-2-phenoxybenzo[c][1,2]benzodithiine?
The IUPAC name of 9-methoxy-3,8-dimethyl-2-phenoxybenzo[c][1,2]benzodithiine (CID 59167349) is 9-methoxy-3,8-dimethyl-2-phenoxybenzo[c][1,2]benzodithiine.
What is the SMILES notation for 9-methoxy-3,8-dimethyl-2-phenoxybenzo[c][1,2]benzodithiine?
The canonical SMILES for 9-methoxy-3,8-dimethyl-2-phenoxybenzo[c][1,2]benzodithiine is COc1cc2c(cc1C)SSc1cc(C)c(Oc3ccccc3)cc1-2.
What is the InChIKey of 9-methoxy-3,8-dimethyl-2-phenoxybenzo[c][1,2]benzodithiine?
The InChIKey is QAUUAZHBPPRKJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18O2S2/c1-13-9-20-16(11-18(13)22-3)17-12-19(14(2)10-21(17)25-24-20)23-15-7-5-4-6-8-15/h4-12H,1-3H3.
What are the key properties of 9-methoxy-3,8-dimethyl-2-phenoxybenzo[c][1,2]benzodithiine?
9-methoxy-3,8-dimethyl-2-phenoxybenzo[c][1,2]benzodithiine has a molecular weight of 366.51 g/mol, XLogP of 6.88, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-methoxy-3,8-dimethyl-2-phenoxybenzo[c][1,2]benzodithiine is sourced from PubChem (CID 59167349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).