C30H25NOSi — CID 59167350
10-methoxy-5,9-dimethyl-7,7-diphenyl-[1]benzosilolo[3,2-f]quinoline (PubChem CID 59167350) has the molecular formula C30H25NOSi and a molecular weight of 443.62 g/mol. Its IUPAC name is 10-methoxy-5,9-dimethyl-7,7-diphenyl-[1]benzosilolo[3,2-f]quinoline.
| Compound Name | 10-methoxy-5,9-dimethyl-7,7-diphenyl-[1]benzosilolo[3,2-f]quinoline |
|---|---|
| PubChem CID | 59167350 |
| Molecular Formula | C30H25NOSi |
| Molecular Weight | 443.62 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | 10-methoxy-5,9-dimethyl-7,7-diphenyl-[1]benzosilolo[3,2-f]quinoline |
| SMILES | COc1cc2c(cc1C)[Si](c1ccccc1)(c1ccccc1)c1cc(C)c3ncccc3c1-2 |
| InChI | InChI=1S/C30H25NOSi/c1-20-17-27-25(19-26(20)32-3)29-24-15-10-16-31-30(24)21(2)18-28(29)33(27,22-11-6-4-7-12-22)23-13-8-5-9-14-23/h4-19H,1-3H3 |
| InChIKey | JXWALYCVPCAQRY-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.62 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|