About N-[2-(benzylideneamino)-3,8-dimethylbenzo[c][1,2]benzodithiin-9-yl]-1-phenylmethanimine
N-[2-(benzylideneamino)-3,8-dimethylbenzo[c][1,2]benzodithiin-9-yl]-1-phenylmethanimine (PubChem CID 59167423) has the molecular formula C28H22N2S2
and a molecular weight of 450.63 g/mol. Its IUPAC name is N-[2-(benzylideneamino)-3,8-dimethylbenzo[c][1,2]benzodithiin-9-yl]-1-phenylmethanimine.
Molecular Properties
| Compound Name | N-[2-(benzylideneamino)-3,8-dimethylbenzo[c][1,2]benzodithiin-9-yl]-1-phenylmethanimine |
| PubChem CID | 59167423 |
| Molecular Formula | C28H22N2S2 |
| Molecular Weight | 450.63 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | N-[2-(benzylideneamino)-3,8-dimethylbenzo[c][1,2]benzodithiin-9-yl]-1-phenylmethanimine |
| SMILES | Cc1cc2c(cc1/N=C/c1ccccc1)-c1cc(/N=C/c3ccccc3)c(C)cc1SS2 |
| InChI | InChI=1S/C28H22N2S2/c1-19-13-27-23(15-25(19)29-17-21-9-5-3-6-10-21)24-16-26(20(2)14-28(24)32-31-27)30-18-22-11-7-4-8-12-22/h3-18H,1-2H3/b29-17+,30-18+ |
| InChIKey | OMIVDTFOGUNELA-YAGSLNJISA-N |
| XLogP | 8.58 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 450.63 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(benzylideneamino)-3,8-dimethylbenzo[c][1,2]benzodithiin-9-yl]-1-phenylmethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(benzylideneamino)-3,8-dimethylbenzo[c][1,2]benzodithiin-9-yl]-1-phenylmethanimine?
The IUPAC name of N-[2-(benzylideneamino)-3,8-dimethylbenzo[c][1,2]benzodithiin-9-yl]-1-phenylmethanimine (CID 59167423) is N-[2-(benzylideneamino)-3,8-dimethylbenzo[c][1,2]benzodithiin-9-yl]-1-phenylmethanimine.
What is the SMILES notation for N-[2-(benzylideneamino)-3,8-dimethylbenzo[c][1,2]benzodithiin-9-yl]-1-phenylmethanimine?
The canonical SMILES for N-[2-(benzylideneamino)-3,8-dimethylbenzo[c][1,2]benzodithiin-9-yl]-1-phenylmethanimine is Cc1cc2c(cc1/N=C/c1ccccc1)-c1cc(/N=C/c3ccccc3)c(C)cc1SS2.
What is the InChIKey of N-[2-(benzylideneamino)-3,8-dimethylbenzo[c][1,2]benzodithiin-9-yl]-1-phenylmethanimine?
The InChIKey is OMIVDTFOGUNELA-YAGSLNJISA-N. The full InChI is InChI=1S/C28H22N2S2/c1-19-13-27-23(15-25(19)29-17-21-9-5-3-6-10-21)24-16-26(20(2)14-28(24)32-31-27)30-18-22-11-7-4-8-12-22/h3-18H,1-2H3/b29-17+,30-18+.
What are the key properties of N-[2-(benzylideneamino)-3,8-dimethylbenzo[c][1,2]benzodithiin-9-yl]-1-phenylmethanimine?
N-[2-(benzylideneamino)-3,8-dimethylbenzo[c][1,2]benzodithiin-9-yl]-1-phenylmethanimine has a molecular weight of 450.63 g/mol, XLogP of 8.58, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(benzylideneamino)-3,8-dimethylbenzo[c][1,2]benzodithiin-9-yl]-1-phenylmethanimine is sourced from PubChem (CID 59167423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).