About 3,8-dimethyl-2-phenoxybenzo[c][1,2]benzodithiine
3,8-dimethyl-2-phenoxybenzo[c][1,2]benzodithiine (PubChem CID 59167440) has the molecular formula C20H16OS2
and a molecular weight of 336.48 g/mol. Its IUPAC name is 3,8-dimethyl-2-phenoxybenzo[c][1,2]benzodithiine.
Molecular Properties
| Compound Name | 3,8-dimethyl-2-phenoxybenzo[c][1,2]benzodithiine |
| PubChem CID | 59167440 |
| Molecular Formula | C20H16OS2 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | 3,8-dimethyl-2-phenoxybenzo[c][1,2]benzodithiine |
| SMILES | Cc1ccc2c(c1)SSc1cc(C)c(Oc3ccccc3)cc1-2 |
| InChI | InChI=1S/C20H16OS2/c1-13-8-9-16-17-12-18(21-15-6-4-3-5-7-15)14(2)11-20(17)23-22-19(16)10-13/h3-12H,1-2H3 |
| InChIKey | URIKDDYBFANDIR-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|
Analyze 3,8-dimethyl-2-phenoxybenzo[c][1,2]benzodithiine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,8-dimethyl-2-phenoxybenzo[c][1,2]benzodithiine?
The IUPAC name of 3,8-dimethyl-2-phenoxybenzo[c][1,2]benzodithiine (CID 59167440) is 3,8-dimethyl-2-phenoxybenzo[c][1,2]benzodithiine.
What is the SMILES notation for 3,8-dimethyl-2-phenoxybenzo[c][1,2]benzodithiine?
The canonical SMILES for 3,8-dimethyl-2-phenoxybenzo[c][1,2]benzodithiine is Cc1ccc2c(c1)SSc1cc(C)c(Oc3ccccc3)cc1-2.
What is the InChIKey of 3,8-dimethyl-2-phenoxybenzo[c][1,2]benzodithiine?
The InChIKey is URIKDDYBFANDIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16OS2/c1-13-8-9-16-17-12-18(21-15-6-4-3-5-7-15)14(2)11-20(17)23-22-19(16)10-13/h3-12H,1-2H3.
What are the key properties of 3,8-dimethyl-2-phenoxybenzo[c][1,2]benzodithiine?
3,8-dimethyl-2-phenoxybenzo[c][1,2]benzodithiine has a molecular weight of 336.48 g/mol, XLogP of 6.88, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,8-dimethyl-2-phenoxybenzo[c][1,2]benzodithiine is sourced from PubChem (CID 59167440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).