C13H16O — CID 59167729
3-ethoxytricyclo[6.2.1.02,7]undeca-2(7),3,5-triene (PubChem CID 59167729) has the molecular formula C13H16O and a molecular weight of 188.27 g/mol. Its IUPAC name is 3-ethoxytricyclo[6.2.1.02,7]undeca-2(7),3,5-triene.
| Compound Name | 3-ethoxytricyclo[6.2.1.02,7]undeca-2(7),3,5-triene |
|---|---|
| PubChem CID | 59167729 |
| Molecular Formula | C13H16O |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | 3-ethoxytricyclo[6.2.1.02,7]undeca-2(7),3,5-triene |
| SMILES | CCOc1cccc2c1C1CCC2C1 |
| InChI | InChI=1S/C13H16O/c1-2-14-12-5-3-4-11-9-6-7-10(8-9)13(11)12/h3-5,9-10H,2,6-8H2,1H3 |
| InChIKey | ADUGTFYHNPGZCZ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |