C20H31N3O3 — CID 59167821
(1S,4R,7Z,14S,18R)-4-acetyl-14-amino-18-methyl-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-ene-2,15-dione (PubChem CID 59167821) has the molecular formula C20H31N3O3 and a molecular weight of 361.49 g/mol. Its IUPAC name is (1S,4R,7Z,14S,18R)-4-acetyl-14-amino-18-methyl-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-ene-2,15-dione.
| Compound Name | (1S,4R,7Z,14S,18R)-4-acetyl-14-amino-18-methyl-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-ene-2,15-dione |
|---|---|
| PubChem CID | 59167821 |
| Molecular Formula | C20H31N3O3 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.24 |
| IUPAC Name | (1S,4R,7Z,14S,18R)-4-acetyl-14-amino-18-methyl-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-ene-2,15-dione |
| SMILES | CC(=O)[C@@]12CC1/C=C\CCCCC[C@H](N)C(=O)N1C[C@H](C)C[C@H]1C(=O)N2 |
| InChI | InChI=1S/C20H31N3O3/c1-13-10-17-18(25)22-20(14(2)24)11-15(20)8-6-4-3-5-7-9-16(21)19(26)23(17)12-13/h6,8,13,15-17H,3-5,7,9-12,21H2,1-2H3,(H,22,25)/b8-6-/t13-,15?,16+,17+,20+/m1/s1 |
| InChIKey | WEYURTLJJVXSQO-VIXZBIFGSA-N |
| XLogP | 1.53 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|