C44H32N4 — CID 59167867
(5Z,10Z,14Z,19Z)-5,10,15,20-tetraphenyl-1,2,21,23-tetrahydroporphyrin (PubChem CID 59167867) has the molecular formula C44H32N4 and a molecular weight of 616.77 g/mol. Its IUPAC name is (5Z,10Z,14Z,19Z)-5,10,15,20-tetraphenyl-1,2,21,23-tetrahydroporphyrin.
| Compound Name | (5Z,10Z,14Z,19Z)-5,10,15,20-tetraphenyl-1,2,21,23-tetrahydroporphyrin |
|---|---|
| PubChem CID | 59167867 |
| Molecular Formula | C44H32N4 |
| Molecular Weight | 616.77 g/mol |
| Exact Mass | 616.26 |
| IUPAC Name | (5Z,10Z,14Z,19Z)-5,10,15,20-tetraphenyl-1,2,21,23-tetrahydroporphyrin |
| SMILES | C1=C/C2=C(\c3ccccc3)C3=CCC(N3)/C(c3ccccc3)=C3/C=CC(=N3)/C(c3ccccc3)=c3/cc/c([nH]3)=C(\c3ccccc3)C1=N2 |
| InChI | InChI=1S/C44H32N4/c1-5-13-29(14-6-1)41-33-21-23-35(45-33)42(30-15-7-2-8-16-30)37-25-27-39(47-37)44(32-19-11-4-12-20-32)40-28-26-38(48-40)43(31-17-9-3-10-18-31)36-24-22-34(41)46-36/h1-27,40,45,48H,28H2/b41-33-,42-35-,43-36-,44-39- |
| InChIKey | ONDPAALTMYWFDG-DLJQTLRXSA-N |
| XLogP | 7.52 |
| TPSA | 52.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.77 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |