C16H23N3O2 — CID 59167873
(1R)-7-nitro-6-(piperidin-1-ylmethyl)-1,2,3,4-tetrahydronaphthalen-1-amine (PubChem CID 59167873) has the molecular formula C16H23N3O2 and a molecular weight of 289.38 g/mol. Its IUPAC name is (1R)-7-nitro-6-(piperidin-1-ylmethyl)-1,2,3,4-tetrahydronaphthalen-1-amine.
| Compound Name | (1R)-7-nitro-6-(piperidin-1-ylmethyl)-1,2,3,4-tetrahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 59167873 |
| Molecular Formula | C16H23N3O2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | (1R)-7-nitro-6-(piperidin-1-ylmethyl)-1,2,3,4-tetrahydronaphthalen-1-amine |
| SMILES | N[C@@H]1CCCc2cc(CN3CCCCC3)c([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C16H23N3O2/c17-15-6-4-5-12-9-13(11-18-7-2-1-3-8-18)16(19(20)21)10-14(12)15/h9-10,15H,1-8,11,17H2/t15-/m1/s1 |
| InChIKey | VRNLXHIXJBLECM-OAHLLOKOSA-N |
| XLogP | 2.92 |
| TPSA | 72.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|