C35H44F2N2O4Si — CID 59167989
tert-butyl (2R)-2-[(1S,2S)-2-(dibenzylamino)-3-(3,5-difluorophenyl)-1-trimethylsilyloxypropyl]-5-oxopyrrolidine-1-carboxylate (PubChem CID 59167989) has the molecular formula C35H44F2N2O4Si and a molecular weight of 622.83 g/mol. Its IUPAC name is tert-butyl (2R)-2-[(1S,2S)-2-(dibenzylamino)-3-(3,5-difluorophenyl)-1-trimethylsilyloxypropyl]-5-oxopyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R)-2-[(1S,2S)-2-(dibenzylamino)-3-(3,5-difluorophenyl)-1-trimethylsilyloxypropyl]-5-oxopyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 59167989 |
| Molecular Formula | C35H44F2N2O4Si |
| Molecular Weight | 622.83 g/mol |
| Exact Mass | 622.30 |
| IUPAC Name | tert-butyl (2R)-2-[(1S,2S)-2-(dibenzylamino)-3-(3,5-difluorophenyl)-1-trimethylsilyloxypropyl]-5-oxopyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)CC[C@@H]1[C@@H](O[Si](C)(C)C)[C@H](Cc1cc(F)cc(F)c1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C35H44F2N2O4Si/c1-35(2,3)42-34(41)39-30(17-18-32(39)40)33(43-44(4,5)6)31(21-27-19-28(36)22-29(37)20-27)38(23-25-13-9-7-10-14-25)24-26-15-11-8-12-16-26/h7-16,19-20,22,30-31,33H,17-18,21,23-24H2,1-6H3/t30-,31+,33-/m1/s1 |
| InChIKey | PZRGULAEKPJDLC-IALKSABESA-N |
| XLogP | 7.72 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.83 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|