About CID 59168467
CID 59168467 (PubChem CID 59168467) has the molecular formula C19H28OSi2
and a molecular weight of 328.60 g/mol.
Molecular Properties
| Compound Name | CID 59168467 |
| PubChem CID | 59168467 |
| Molecular Formula | C19H28OSi2 |
| Molecular Weight | 328.60 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | — |
| SMILES | C[Si](C)CCCCCOc1ccc2cc([Si](C)C)ccc2c1 |
| InChI | InChI=1S/C19H28OSi2/c1-21(2)13-7-5-6-12-20-18-10-8-17-15-19(22(3)4)11-9-16(17)14-18/h8-11,14-15H,5-7,12-13H2,1-4H3 |
| InChIKey | JGCNFRQYBDUGIJ-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 328.60 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 59168467 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59168467?
The IUPAC name of CID 59168467 (CID 59168467) is not available.
What is the SMILES notation for CID 59168467?
The canonical SMILES for CID 59168467 is C[Si](C)CCCCCOc1ccc2cc([Si](C)C)ccc2c1.
What is the InChIKey of CID 59168467?
The InChIKey is JGCNFRQYBDUGIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H28OSi2/c1-21(2)13-7-5-6-12-20-18-10-8-17-15-19(22(3)4)11-9-16(17)14-18/h8-11,14-15H,5-7,12-13H2,1-4H3.
What are the key properties of CID 59168467?
CID 59168467 has a molecular weight of 328.60 g/mol, XLogP of 5.10, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59168467 is sourced from PubChem (CID 59168467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).