C28H26Br4O2 — CID 59168498
1,3-dibromo-2-but-3-enoxy-5-[1-(3,5-dibromo-4-but-3-enoxyphenyl)-1-phenylethyl]benzene (PubChem CID 59168498) has the molecular formula C28H26Br4O2 and a molecular weight of 714.13 g/mol. Its IUPAC name is 1,3-dibromo-2-but-3-enoxy-5-[1-(3,5-dibromo-4-but-3-enoxyphenyl)-1-phenylethyl]benzene.
| Compound Name | 1,3-dibromo-2-but-3-enoxy-5-[1-(3,5-dibromo-4-but-3-enoxyphenyl)-1-phenylethyl]benzene |
|---|---|
| PubChem CID | 59168498 |
| Molecular Formula | C28H26Br4O2 |
| Molecular Weight | 714.13 g/mol |
| Exact Mass | 709.87 |
| IUPAC Name | 1,3-dibromo-2-but-3-enoxy-5-[1-(3,5-dibromo-4-but-3-enoxyphenyl)-1-phenylethyl]benzene |
| SMILES | C=CCCOc1c(Br)cc(C(C)(c2ccccc2)c2cc(Br)c(OCCC=C)c(Br)c2)cc1Br |
| InChI | InChI=1S/C28H26Br4O2/c1-4-6-13-33-26-22(29)15-20(16-23(26)30)28(3,19-11-9-8-10-12-19)21-17-24(31)27(25(32)18-21)34-14-7-5-2/h4-5,8-12,15-18H,1-2,6-7,13-14H2,3H3 |
| InChIKey | UJJYGBGFGPAAEL-UHFFFAOYSA-N |
| XLogP | 10.00 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.13 |
| LogP ≤ 5 | 10.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|