C29H35Cl2N3O3Ru — CID 59168580
1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ide;dichloro-[(2-methyloxonio-5-nitrophenyl)methylidene]ruthenium (PubChem CID 59168580) has the molecular formula C29H35Cl2N3O3Ru and a molecular weight of 645.59 g/mol. Its IUPAC name is 1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ide;dichloro-[(2-methyloxonio-5-nitrophenyl)methylidene]ruthenium.
| Compound Name | 1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ide;dichloro-[(2-methyloxonio-5-nitrophenyl)methylidene]ruthenium |
|---|---|
| PubChem CID | 59168580 |
| Molecular Formula | C29H35Cl2N3O3Ru |
| Molecular Weight | 645.59 g/mol |
| Exact Mass | 645.11 |
| IUPAC Name | 1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ide;dichloro-[(2-methyloxonio-5-nitrophenyl)methylidene]ruthenium |
| SMILES | C[OH+]c1ccc([N+](=O)[O-])cc1C=[Ru](Cl)Cl.Cc1cc(C)c(N2[CH-]N(c3c(C)cc(C)cc3C)CC2)c(C)c1 |
| InChI | InChI=1S/C21H27N2.C8H7NO3.2ClH.Ru/c1-14-9-16(3)20(17(4)10-14)22-7-8-23(13-22)21-18(5)11-15(2)12-19(21)6;1-6-5-7(9(10)11)3-4-8(6)12-2;;;/h9-13H,7-8H2,1-6H3;1,3-5H,2H3;2*1H;/q-1;;;;+2/p-1 |
| InChIKey | ZCIAPOGLAAACHL-UHFFFAOYSA-M |
| XLogP | 7.53 |
| TPSA | 62.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.59 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|