C5H9NO2 — CID 59168915
3,6-dimethyl-5,6-dihydro-1,4,2-dioxazine (PubChem CID 59168915) has the molecular formula C5H9NO2 and a molecular weight of 115.13 g/mol. Its IUPAC name is 3,6-dimethyl-5,6-dihydro-1,4,2-dioxazine.
| Compound Name | 3,6-dimethyl-5,6-dihydro-1,4,2-dioxazine |
|---|---|
| PubChem CID | 59168915 |
| Molecular Formula | C5H9NO2 |
| Molecular Weight | 115.13 g/mol |
| Exact Mass | 115.06 |
| IUPAC Name | 3,6-dimethyl-5,6-dihydro-1,4,2-dioxazine |
| SMILES | CC1=NOC(C)CO1 |
| InChI | InChI=1S/C5H9NO2/c1-4-3-7-5(2)6-8-4/h4H,3H2,1-2H3 |
| InChIKey | ITTOICDLBIVIOP-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 115.13 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |