C14H33BrO14Si8 — CID 59168998
3-(3,5,7,9,11,13,15-heptamethyl-2,4,6,8,10,12,14,16,17,18,19,20-dodecaoxa-1,3,5,7,9,11,13,15-octasilapentacyclo[9.5.1.13,9.15,15.17,13]icosan-1-yl)propyl 2-bromo-2-methylpropanoate (PubChem CID 59168998) has the molecular formula C14H33BrO14Si8 and a molecular weight of 730.00 g/mol. Its IUPAC name is 3-(3,5,7,9,11,13,15-heptamethyl-2,4,6,8,10,12,14,16,17,18,19,20-dodecaoxa-1,3,5,7,9,11,13,15-octasilapentacyclo[9.5.1.13,9.15,15.17,13]icosan-1-yl)propyl 2-bromo-2-methylpropanoate.
| Compound Name | 3-(3,5,7,9,11,13,15-heptamethyl-2,4,6,8,10,12,14,16,17,18,19,20-dodecaoxa-1,3,5,7,9,11,13,15-octasilapentacyclo[9.5.1.13,9.15,15.17,13]icosan-1-yl)propyl 2-bromo-2-methylpropanoate |
|---|---|
| PubChem CID | 59168998 |
| Molecular Formula | C14H33BrO14Si8 |
| Molecular Weight | 730.00 g/mol |
| Exact Mass | 727.92 |
| IUPAC Name | 3-(3,5,7,9,11,13,15-heptamethyl-2,4,6,8,10,12,14,16,17,18,19,20-dodecaoxa-1,3,5,7,9,11,13,15-octasilapentacyclo[9.5.1.13,9.15,15.17,13]icosan-1-yl)propyl 2-bromo-2-methylpropanoate |
| SMILES | CC(C)(Br)C(=O)OCCC[Si]12O[Si]3(C)O[Si]4(C)O[Si]5(C)O[Si](C)(O3)O[Si](C)(O[Si](C)(O5)O[Si](C)(O4)O1)O2 |
| InChI | InChI=1S/C14H33BrO14Si8/c1-14(2,15)13(16)17-11-10-12-37-27-34(7)21-31(4)18-30(3)19-32(5,23-34)25-36(9,29-37)26-33(6,20-30)24-35(8,22-31)28-37/h10-12H2,1-9H3 |
| InChIKey | WLUIANZUHFXLAH-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 137.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.00 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|