About (E)-2,4-diethyl-5-hydroxyoct-2-enal
(E)-2,4-diethyl-5-hydroxyoct-2-enal (PubChem CID 59169069) has the molecular formula C12H22O2
and a molecular weight of 198.31 g/mol. Its IUPAC name is (E)-2,4-diethyl-5-hydroxyoct-2-enal.
Molecular Properties
| Compound Name | (E)-2,4-diethyl-5-hydroxyoct-2-enal |
| PubChem CID | 59169069 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | (E)-2,4-diethyl-5-hydroxyoct-2-enal |
| SMILES | CCCC(O)C(/C=C(/C=O)CC)CC |
| InChI | InChI=1S/C12H22O2/c1-4-7-12(14)11(6-3)8-10(5-2)9-13/h8-9,11-12,14H,4-7H2,1-3H3/b10-8+ |
| InChIKey | ACBBOQQUVUDDSA-CSKARUKUSA-N |
| XLogP | 2.71 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-2,4-diethyl-5-hydroxyoct-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2,4-diethyl-5-hydroxyoct-2-enal?
The IUPAC name of (E)-2,4-diethyl-5-hydroxyoct-2-enal (CID 59169069) is (E)-2,4-diethyl-5-hydroxyoct-2-enal.
What is the SMILES notation for (E)-2,4-diethyl-5-hydroxyoct-2-enal?
The canonical SMILES for (E)-2,4-diethyl-5-hydroxyoct-2-enal is CCCC(O)C(/C=C(/C=O)CC)CC.
What is the InChIKey of (E)-2,4-diethyl-5-hydroxyoct-2-enal?
The InChIKey is ACBBOQQUVUDDSA-CSKARUKUSA-N. The full InChI is InChI=1S/C12H22O2/c1-4-7-12(14)11(6-3)8-10(5-2)9-13/h8-9,11-12,14H,4-7H2,1-3H3/b10-8+.
What are the key properties of (E)-2,4-diethyl-5-hydroxyoct-2-enal?
(E)-2,4-diethyl-5-hydroxyoct-2-enal has a molecular weight of 198.31 g/mol, XLogP of 2.71, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2,4-diethyl-5-hydroxyoct-2-enal is sourced from PubChem (CID 59169069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).