C31H44O6Si — CID 59169504
[(3aR,5R,6S,6aR)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2,6-trimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]methyl 2,2-dimethylpropanoate (PubChem CID 59169504) has the molecular formula C31H44O6Si and a molecular weight of 540.77 g/mol. Its IUPAC name is [(3aR,5R,6S,6aR)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2,6-trimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(3aR,5R,6S,6aR)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2,6-trimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 59169504 |
| Molecular Formula | C31H44O6Si |
| Molecular Weight | 540.77 g/mol |
| Exact Mass | 540.29 |
| IUPAC Name | [(3aR,5R,6S,6aR)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2,6-trimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]methyl 2,2-dimethylpropanoate |
| SMILES | C[C@H]1[C@H]2OC(C)(C)O[C@H]2O[C@]1(COC(=O)C(C)(C)C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C31H44O6Si/c1-22-25-26(36-30(8,9)35-25)37-31(22,20-33-27(32)28(2,3)4)21-34-38(29(5,6)7,23-16-12-10-13-17-23)24-18-14-11-15-19-24/h10-19,22,25-26H,20-21H2,1-9H3/t22-,25+,26-,31+/m0/s1 |
| InChIKey | HKAMPYOPDXDKCJ-ZFXCNGLTSA-N |
| XLogP | 5.03 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.77 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|