C17H28O6 — CID 59169519
[(3aR,5R,6S,6aR)-5-[(1S)-1-hydroxyprop-2-enyl]-2,2,6-trimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]methyl 2,2-dimethylpropanoate (PubChem CID 59169519) has the molecular formula C17H28O6 and a molecular weight of 328.41 g/mol. Its IUPAC name is [(3aR,5R,6S,6aR)-5-[(1S)-1-hydroxyprop-2-enyl]-2,2,6-trimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(3aR,5R,6S,6aR)-5-[(1S)-1-hydroxyprop-2-enyl]-2,2,6-trimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 59169519 |
| Molecular Formula | C17H28O6 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | [(3aR,5R,6S,6aR)-5-[(1S)-1-hydroxyprop-2-enyl]-2,2,6-trimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]methyl 2,2-dimethylpropanoate |
| SMILES | C=C[C@H](O)[C@@]1(COC(=O)C(C)(C)C)O[C@@H]2OC(C)(C)O[C@@H]2[C@@H]1C |
| InChI | InChI=1S/C17H28O6/c1-8-11(18)17(9-20-14(19)15(3,4)5)10(2)12-13(23-17)22-16(6,7)21-12/h8,10-13,18H,1,9H2,2-7H3/t10-,11-,12+,13-,17-/m0/s1 |
| InChIKey | IJZYCDWVDOXFFR-QLLRCSDMSA-N |
| XLogP | 2.01 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|