About N-(1,3-benzothiazol-2-yl)-3,3-diphenylpropanamide
N-(1,3-benzothiazol-2-yl)-3,3-diphenylpropanamide (PubChem CID 591698) has the molecular formula C22H18N2OS
and a molecular weight of 358.47 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-3,3-diphenylpropanamide.
Molecular Properties
| Compound Name | N-(1,3-benzothiazol-2-yl)-3,3-diphenylpropanamide |
| PubChem CID | 591698 |
| Molecular Formula | C22H18N2OS |
| Molecular Weight | 358.47 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-3,3-diphenylpropanamide |
| SMILES | O=C(CC(c1ccccc1)c1ccccc1)Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C22H18N2OS/c25-21(24-22-23-19-13-7-8-14-20(19)26-22)15-18(16-9-3-1-4-10-16)17-11-5-2-6-12-17/h1-14,18H,15H2,(H,23,24,25) |
| InChIKey | GYQWKTIZRYVFEM-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 358.47 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(1,3-benzothiazol-2-yl)-3,3-diphenylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,3-benzothiazol-2-yl)-3,3-diphenylpropanamide?
The IUPAC name of N-(1,3-benzothiazol-2-yl)-3,3-diphenylpropanamide (CID 591698) is N-(1,3-benzothiazol-2-yl)-3,3-diphenylpropanamide.
What is the SMILES notation for N-(1,3-benzothiazol-2-yl)-3,3-diphenylpropanamide?
The canonical SMILES for N-(1,3-benzothiazol-2-yl)-3,3-diphenylpropanamide is O=C(CC(c1ccccc1)c1ccccc1)Nc1nc2ccccc2s1.
What is the InChIKey of N-(1,3-benzothiazol-2-yl)-3,3-diphenylpropanamide?
The InChIKey is GYQWKTIZRYVFEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H18N2OS/c25-21(24-22-23-19-13-7-8-14-20(19)26-22)15-18(16-9-3-1-4-10-16)17-11-5-2-6-12-17/h1-14,18H,15H2,(H,23,24,25).
What are the key properties of N-(1,3-benzothiazol-2-yl)-3,3-diphenylpropanamide?
N-(1,3-benzothiazol-2-yl)-3,3-diphenylpropanamide has a molecular weight of 358.47 g/mol, XLogP of 5.46, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,3-benzothiazol-2-yl)-3,3-diphenylpropanamide is sourced from PubChem (CID 591698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).