C35H35N3O4 — CID 59169885
1-(2-methoxyethyl)-3-[(3-methoxyphenyl)methyl]-8-(pyren-1-ylmethyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 59169885) has the molecular formula C35H35N3O4 and a molecular weight of 561.68 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-3-[(3-methoxyphenyl)methyl]-8-(pyren-1-ylmethyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 1-(2-methoxyethyl)-3-[(3-methoxyphenyl)methyl]-8-(pyren-1-ylmethyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 59169885 |
| Molecular Formula | C35H35N3O4 |
| Molecular Weight | 561.68 g/mol |
| Exact Mass | 561.26 |
| IUPAC Name | 1-(2-methoxyethyl)-3-[(3-methoxyphenyl)methyl]-8-(pyren-1-ylmethyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | COCCN1C(=O)N(Cc2cccc(OC)c2)C(=O)C12CCN(Cc1ccc3ccc4cccc5ccc1c3c45)CC2 |
| InChI | InChI=1S/C35H35N3O4/c1-41-20-19-38-34(40)37(22-24-5-3-8-29(21-24)42-2)33(39)35(38)15-17-36(18-16-35)23-28-12-11-27-10-9-25-6-4-7-26-13-14-30(28)32(27)31(25)26/h3-14,21H,15-20,22-23H2,1-2H3 |
| InChIKey | RMAYVCWKCMUHMA-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.68 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|