C18H28N4O3 — CID 59169997
(2E,4E)-5-[1-ethenyl-5-(2-methoxyethylamino)-4-pentylimidazol-2-yl]-N-hydroxypenta-2,4-dienamide (PubChem CID 59169997) has the molecular formula C18H28N4O3 and a molecular weight of 348.45 g/mol. Its IUPAC name is (2E,4E)-5-[1-ethenyl-5-(2-methoxyethylamino)-4-pentylimidazol-2-yl]-N-hydroxypenta-2,4-dienamide.
| Compound Name | (2E,4E)-5-[1-ethenyl-5-(2-methoxyethylamino)-4-pentylimidazol-2-yl]-N-hydroxypenta-2,4-dienamide |
|---|---|
| PubChem CID | 59169997 |
| Molecular Formula | C18H28N4O3 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | (2E,4E)-5-[1-ethenyl-5-(2-methoxyethylamino)-4-pentylimidazol-2-yl]-N-hydroxypenta-2,4-dienamide |
| SMILES | C=Cn1c(/C=C/C=C/C(=O)NO)nc(CCCCC)c1NCCOC |
| InChI | InChI=1S/C18H28N4O3/c1-4-6-7-10-15-18(19-13-14-25-3)22(5-2)16(20-15)11-8-9-12-17(23)21-24/h5,8-9,11-12,19,24H,2,4,6-7,10,13-14H2,1,3H3,(H,21,23)/b11-8+,12-9+ |
| InChIKey | LDBGDMMDPCTWQB-HZOWPXDZSA-N |
| XLogP | 2.85 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|