About methyl 2-(3-acetyloxy-3-tricyclo[5.2.1.02,6]deca-4,8-dienyl)propanoate
methyl 2-(3-acetyloxy-3-tricyclo[5.2.1.02,6]deca-4,8-dienyl)propanoate (PubChem CID 591701) has the molecular formula C16H20O4
and a molecular weight of 276.33 g/mol. Its IUPAC name is methyl 2-(3-acetyloxy-3-tricyclo[5.2.1.02,6]deca-4,8-dienyl)propanoate.
Molecular Properties
| Compound Name | methyl 2-(3-acetyloxy-3-tricyclo[5.2.1.02,6]deca-4,8-dienyl)propanoate |
| PubChem CID | 591701 |
| Molecular Formula | C16H20O4 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | methyl 2-(3-acetyloxy-3-tricyclo[5.2.1.02,6]deca-4,8-dienyl)propanoate |
| SMILES | COC(=O)C(C)C1(OC(C)=O)C=CC2C3C=CC(C3)C21 |
| InChI | InChI=1S/C16H20O4/c1-9(15(18)19-3)16(20-10(2)17)7-6-13-11-4-5-12(8-11)14(13)16/h4-7,9,11-14H,8H2,1-3H3 |
| InChIKey | STZHTCLJIBBQOR-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-(3-acetyloxy-3-tricyclo[5.2.1.02,6]deca-4,8-dienyl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(3-acetyloxy-3-tricyclo[5.2.1.02,6]deca-4,8-dienyl)propanoate?
The IUPAC name of methyl 2-(3-acetyloxy-3-tricyclo[5.2.1.02,6]deca-4,8-dienyl)propanoate (CID 591701) is methyl 2-(3-acetyloxy-3-tricyclo[5.2.1.02,6]deca-4,8-dienyl)propanoate.
What is the SMILES notation for methyl 2-(3-acetyloxy-3-tricyclo[5.2.1.02,6]deca-4,8-dienyl)propanoate?
The canonical SMILES for methyl 2-(3-acetyloxy-3-tricyclo[5.2.1.02,6]deca-4,8-dienyl)propanoate is COC(=O)C(C)C1(OC(C)=O)C=CC2C3C=CC(C3)C21.
What is the InChIKey of methyl 2-(3-acetyloxy-3-tricyclo[5.2.1.02,6]deca-4,8-dienyl)propanoate?
The InChIKey is STZHTCLJIBBQOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20O4/c1-9(15(18)19-3)16(20-10(2)17)7-6-13-11-4-5-12(8-11)14(13)16/h4-7,9,11-14H,8H2,1-3H3.
What are the key properties of methyl 2-(3-acetyloxy-3-tricyclo[5.2.1.02,6]deca-4,8-dienyl)propanoate?
methyl 2-(3-acetyloxy-3-tricyclo[5.2.1.02,6]deca-4,8-dienyl)propanoate has a molecular weight of 276.33 g/mol, XLogP of 2.11, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(3-acetyloxy-3-tricyclo[5.2.1.02,6]deca-4,8-dienyl)propanoate is sourced from PubChem (CID 591701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).