C16H6N4O2S4 — CID 59171469
2-[2-(diisocyanomethylidene)-4,8-dimethoxy-[1,3]dithiolo[4,5-f][1,3]benzodithiol-6-ylidene]propanedinitrile (PubChem CID 59171469) has the molecular formula C16H6N4O2S4 and a molecular weight of 414.52 g/mol. Its IUPAC name is 2-[2-(diisocyanomethylidene)-4,8-dimethoxy-[1,3]dithiolo[4,5-f][1,3]benzodithiol-6-ylidene]propanedinitrile.
| Compound Name | 2-[2-(diisocyanomethylidene)-4,8-dimethoxy-[1,3]dithiolo[4,5-f][1,3]benzodithiol-6-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 59171469 |
| Molecular Formula | C16H6N4O2S4 |
| Molecular Weight | 414.52 g/mol |
| Exact Mass | 413.94 |
| IUPAC Name | 2-[2-(diisocyanomethylidene)-4,8-dimethoxy-[1,3]dithiolo[4,5-f][1,3]benzodithiol-6-ylidene]propanedinitrile |
| SMILES | [C-]#[N+]C([N+]#[C-])=C1Sc2c(OC)c3c(c(OC)c2S1)SC(=C(C#N)C#N)S3 |
| InChI | InChI=1S/C16H6N4O2S4/c1-19-14(20-2)16-25-12-8(21-3)10-11(9(22-4)13(12)26-16)24-15(23-10)7(5-17)6-18/h3-4H3 |
| InChIKey | SKLUUNAMVJDQBP-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.52 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_cyano_D(3)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|