C16H17NO3S2 — CID 59171596
2-(4,7-dimethoxy-1,3-benzodithiol-2-ylidene)-4,4-dimethyl-3-oxopentanenitrile (PubChem CID 59171596) has the molecular formula C16H17NO3S2 and a molecular weight of 335.45 g/mol. Its IUPAC name is 2-(4,7-dimethoxy-1,3-benzodithiol-2-ylidene)-4,4-dimethyl-3-oxopentanenitrile.
| Compound Name | 2-(4,7-dimethoxy-1,3-benzodithiol-2-ylidene)-4,4-dimethyl-3-oxopentanenitrile |
|---|---|
| PubChem CID | 59171596 |
| Molecular Formula | C16H17NO3S2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | 2-(4,7-dimethoxy-1,3-benzodithiol-2-ylidene)-4,4-dimethyl-3-oxopentanenitrile |
| SMILES | COc1ccc(OC)c2c1SC(=C(C#N)C(=O)C(C)(C)C)S2 |
| InChI | InChI=1S/C16H17NO3S2/c1-16(2,3)14(18)9(8-17)15-21-12-10(19-4)6-7-11(20-5)13(12)22-15/h6-7H,1-5H3 |
| InChIKey | AHKZZFCEESQCHV-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|