C42H38N4S4 — CID 59171825
6-[(E)-2-(4-pentylphenyl)ethenyl]-2-[6-[(E)-2-(4-pentylphenyl)ethenyl]-[1,3]thiazolo[5,4-f][1,3]benzothiazol-2-yl]-[1,3]thiazolo[5,4-f][1,3]benzothiazole (PubChem CID 59171825) has the molecular formula C42H38N4S4 and a molecular weight of 727.06 g/mol. Its IUPAC name is 6-[(E)-2-(4-pentylphenyl)ethenyl]-2-[6-[(E)-2-(4-pentylphenyl)ethenyl]-[1,3]thiazolo[5,4-f][1,3]benzothiazol-2-yl]-[1,3]thiazolo[5,4-f][1,3]benzothiazole.
| Compound Name | 6-[(E)-2-(4-pentylphenyl)ethenyl]-2-[6-[(E)-2-(4-pentylphenyl)ethenyl]-[1,3]thiazolo[5,4-f][1,3]benzothiazol-2-yl]-[1,3]thiazolo[5,4-f][1,3]benzothiazole |
|---|---|
| PubChem CID | 59171825 |
| Molecular Formula | C42H38N4S4 |
| Molecular Weight | 727.06 g/mol |
| Exact Mass | 726.20 |
| IUPAC Name | 6-[(E)-2-(4-pentylphenyl)ethenyl]-2-[6-[(E)-2-(4-pentylphenyl)ethenyl]-[1,3]thiazolo[5,4-f][1,3]benzothiazol-2-yl]-[1,3]thiazolo[5,4-f][1,3]benzothiazole |
| SMILES | CCCCCc1ccc(/C=C/c2nc3cc4sc(-c5nc6cc7sc(/C=C/c8ccc(CCCCC)cc8)nc7cc6s5)nc4cc3s2)cc1 |
| InChI | InChI=1S/C42H38N4S4/c1-3-5-7-9-27-11-15-29(16-12-27)19-21-39-43-31-23-37-33(25-35(31)47-39)45-41(49-37)42-46-34-26-36-32(24-38(34)50-42)44-40(48-36)22-20-30-17-13-28(14-18-30)10-8-6-4-2/h11-26H,3-10H2,1-2H3/b21-19+,22-20+ |
| InChIKey | XAPAJQPGIPJGMO-FLFKKZLDSA-N |
| XLogP | 13.60 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.06 |
| LogP ≤ 5 | 13.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|