C21H23N4O2Pt- — CID 59171914
6-[2-[6-(3-tert-butyl-5H-pyrazol-5-id-1-yl)-2-pyridinyl]propan-2-yl]pyridine-2-carboxylic acid;platinum (PubChem CID 59171914) has the molecular formula C21H23N4O2Pt- and a molecular weight of 558.52 g/mol. Its IUPAC name is 6-[2-[6-(3-tert-butyl-5H-pyrazol-5-id-1-yl)-2-pyridinyl]propan-2-yl]pyridine-2-carboxylic acid;platinum.
| Compound Name | 6-[2-[6-(3-tert-butyl-5H-pyrazol-5-id-1-yl)-2-pyridinyl]propan-2-yl]pyridine-2-carboxylic acid;platinum |
|---|---|
| PubChem CID | 59171914 |
| Molecular Formula | C21H23N4O2Pt- |
| Molecular Weight | 558.52 g/mol |
| Exact Mass | 558.15 |
| IUPAC Name | 6-[2-[6-(3-tert-butyl-5H-pyrazol-5-id-1-yl)-2-pyridinyl]propan-2-yl]pyridine-2-carboxylic acid;platinum |
| SMILES | CC(C)(C)c1c[c-]n(-c2cccc(C(C)(C)c3cccc(C(=O)O)n3)n2)n1.[Pt] |
| InChI | InChI=1S/C21H23N4O2.Pt/c1-20(2,3)15-12-13-25(24-15)18-11-7-10-17(23-18)21(4,5)16-9-6-8-14(22-16)19(26)27;/h6-12H,1-5H3,(H,26,27);/q-1; |
| InChIKey | RYFGWWDYNLBSEI-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.52 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|