C18H24N10O6S2 — CID 59172480
2-[[4-[2,5-dimethyl-4-(1,3,5-triazin-2-ylamino)anilino]-6-(2-sulfoethylamino)-1,3,5-triazin-2-yl]amino]ethanesulfonic acid (PubChem CID 59172480) has the molecular formula C18H24N10O6S2 and a molecular weight of 540.59 g/mol. Its IUPAC name is 2-[[4-[2,5-dimethyl-4-(1,3,5-triazin-2-ylamino)anilino]-6-(2-sulfoethylamino)-1,3,5-triazin-2-yl]amino]ethanesulfonic acid.
| Compound Name | 2-[[4-[2,5-dimethyl-4-(1,3,5-triazin-2-ylamino)anilino]-6-(2-sulfoethylamino)-1,3,5-triazin-2-yl]amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 59172480 |
| Molecular Formula | C18H24N10O6S2 |
| Molecular Weight | 540.59 g/mol |
| Exact Mass | 540.13 |
| IUPAC Name | 2-[[4-[2,5-dimethyl-4-(1,3,5-triazin-2-ylamino)anilino]-6-(2-sulfoethylamino)-1,3,5-triazin-2-yl]amino]ethanesulfonic acid |
| SMILES | Cc1cc(Nc2nc(NCCS(=O)(=O)O)nc(NCCS(=O)(=O)O)n2)c(C)cc1Nc1ncncn1 |
| InChI | InChI=1S/C18H24N10O6S2/c1-11-8-14(12(2)7-13(11)24-15-22-9-19-10-23-15)25-18-27-16(20-3-5-35(29,30)31)26-17(28-18)21-4-6-36(32,33)34/h7-10H,3-6H2,1-2H3,(H,29,30,31)(H,32,33,34)(H,19,22,23,24)(H3,20,21,25,26,27,28) |
| InChIKey | WBUXOQJKUODVDH-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 234.20 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.59 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|