C22H29N11O8 — CID 59172502
2-[[4-(2,3-dihydroxypropylamino)-6-[4-[[4-[ethylamino(hydroxy)methoxy]-1,3,5-triazin-2-yl]amino]anilino]-1,3,5-triazin-2-yl]amino]butanedioic acid (PubChem CID 59172502) has the molecular formula C22H29N11O8 and a molecular weight of 575.54 g/mol. Its IUPAC name is 2-[[4-(2,3-dihydroxypropylamino)-6-[4-[[4-[ethylamino(hydroxy)methoxy]-1,3,5-triazin-2-yl]amino]anilino]-1,3,5-triazin-2-yl]amino]butanedioic acid.
| Compound Name | 2-[[4-(2,3-dihydroxypropylamino)-6-[4-[[4-[ethylamino(hydroxy)methoxy]-1,3,5-triazin-2-yl]amino]anilino]-1,3,5-triazin-2-yl]amino]butanedioic acid |
|---|---|
| PubChem CID | 59172502 |
| Molecular Formula | C22H29N11O8 |
| Molecular Weight | 575.54 g/mol |
| Exact Mass | 575.22 |
| IUPAC Name | 2-[[4-(2,3-dihydroxypropylamino)-6-[4-[[4-[ethylamino(hydroxy)methoxy]-1,3,5-triazin-2-yl]amino]anilino]-1,3,5-triazin-2-yl]amino]butanedioic acid |
| SMILES | CCNC(O)Oc1ncnc(Nc2ccc(Nc3nc(NCC(O)CO)nc(NC(CC(=O)O)C(=O)O)n3)cc2)n1 |
| InChI | InChI=1S/C22H29N11O8/c1-2-23-22(40)41-21-26-10-25-18(33-21)27-11-3-5-12(6-4-11)28-19-30-17(24-8-13(35)9-34)31-20(32-19)29-14(16(38)39)7-15(36)37/h3-6,10,13-14,22-23,34-35,40H,2,7-9H2,1H3,(H,36,37)(H,38,39)(H,25,26,27,33)(H3,24,28,29,30,31,32) |
| InChIKey | HTUHTLPVIBMHLM-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 282.01 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.54 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|