C12H17N7O5S2 — CID 59172515
2-[[4-amino-6-[2-(methanesulfonamido)ethylamino]-1,3,5-triazin-2-yl]amino]benzenesulfonic acid (PubChem CID 59172515) has the molecular formula C12H17N7O5S2 and a molecular weight of 403.45 g/mol. Its IUPAC name is 2-[[4-amino-6-[2-(methanesulfonamido)ethylamino]-1,3,5-triazin-2-yl]amino]benzenesulfonic acid.
| Compound Name | 2-[[4-amino-6-[2-(methanesulfonamido)ethylamino]-1,3,5-triazin-2-yl]amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 59172515 |
| Molecular Formula | C12H17N7O5S2 |
| Molecular Weight | 403.45 g/mol |
| Exact Mass | 403.07 |
| IUPAC Name | 2-[[4-amino-6-[2-(methanesulfonamido)ethylamino]-1,3,5-triazin-2-yl]amino]benzenesulfonic acid |
| SMILES | CS(=O)(=O)NCCNc1nc(N)nc(Nc2ccccc2S(=O)(=O)O)n1 |
| InChI | InChI=1S/C12H17N7O5S2/c1-25(20,21)15-7-6-14-11-17-10(13)18-12(19-11)16-8-4-2-3-5-9(8)26(22,23)24/h2-5,15H,6-7H2,1H3,(H,22,23,24)(H4,13,14,16,17,18,19) |
| InChIKey | UFYSHUAUQOVYBP-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 189.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.45 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|