C15H20O7 — CID 59172687
(4,4-dimethyl-10-oxo-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-9-yl) 2,3-dimethylbut-2-enoate (PubChem CID 59172687) has the molecular formula C15H20O7 and a molecular weight of 312.32 g/mol. Its IUPAC name is (4,4-dimethyl-10-oxo-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-9-yl) 2,3-dimethylbut-2-enoate.
| Compound Name | (4,4-dimethyl-10-oxo-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-9-yl) 2,3-dimethylbut-2-enoate |
|---|---|
| PubChem CID | 59172687 |
| Molecular Formula | C15H20O7 |
| Molecular Weight | 312.32 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | (4,4-dimethyl-10-oxo-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-9-yl) 2,3-dimethylbut-2-enoate |
| SMILES | CC(C)=C(C)C(=O)OC1C(=O)OC2C3OC(C)(C)OC3OC12 |
| InChI | InChI=1S/C15H20O7/c1-6(2)7(3)12(16)19-10-8-9(18-13(10)17)11-14(20-8)22-15(4,5)21-11/h8-11,14H,1-5H3 |
| InChIKey | BZTUDXGIODTHTP-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.32 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|