C14H21F7O3 — CID 59172704
3-(1,1-difluoroethyl)-1-(difluoromethyl)-4-ethyl-2,2,4-trifluoro-1-(2-methoxyethoxymethoxy)cyclopentane (PubChem CID 59172704) has the molecular formula C14H21F7O3 and a molecular weight of 370.31 g/mol. Its IUPAC name is 3-(1,1-difluoroethyl)-1-(difluoromethyl)-4-ethyl-2,2,4-trifluoro-1-(2-methoxyethoxymethoxy)cyclopentane.
| Compound Name | 3-(1,1-difluoroethyl)-1-(difluoromethyl)-4-ethyl-2,2,4-trifluoro-1-(2-methoxyethoxymethoxy)cyclopentane |
|---|---|
| PubChem CID | 59172704 |
| Molecular Formula | C14H21F7O3 |
| Molecular Weight | 370.31 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 3-(1,1-difluoroethyl)-1-(difluoromethyl)-4-ethyl-2,2,4-trifluoro-1-(2-methoxyethoxymethoxy)cyclopentane |
| SMILES | CCC1(F)CC(OCOCCOC)(C(F)F)C(F)(F)C1C(C)(F)F |
| InChI | InChI=1S/C14H21F7O3/c1-4-12(19)7-13(10(15)16,24-8-23-6-5-22-3)14(20,21)9(12)11(2,17)18/h9-10H,4-8H2,1-3H3 |
| InChIKey | YCWOYAFIBHEOCL-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.31 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|