C15H11Cl6N3O2 — CID 59172720
[4-[2-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]ethenyl]-2-(hydroxymethyl)phenyl]methanol (PubChem CID 59172720) has the molecular formula C15H11Cl6N3O2 and a molecular weight of 477.99 g/mol. Its IUPAC name is [4-[2-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]ethenyl]-2-(hydroxymethyl)phenyl]methanol.
| Compound Name | [4-[2-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]ethenyl]-2-(hydroxymethyl)phenyl]methanol |
|---|---|
| PubChem CID | 59172720 |
| Molecular Formula | C15H11Cl6N3O2 |
| Molecular Weight | 477.99 g/mol |
| Exact Mass | 474.90 |
| IUPAC Name | [4-[2-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]ethenyl]-2-(hydroxymethyl)phenyl]methanol |
| SMILES | OCc1ccc(C=Cc2nc(C(Cl)(Cl)Cl)nc(C(Cl)(Cl)Cl)n2)cc1CO |
| InChI | InChI=1S/C15H11Cl6N3O2/c16-14(17,18)12-22-11(23-13(24-12)15(19,20)21)4-2-8-1-3-9(6-25)10(5-8)7-26/h1-5,25-26H,6-7H2 |
| InChIKey | AZYIUMCMSCVKQY-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 79.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.99 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|