C18H11Cl6N3O — CID 59172726
[4-[4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]phenyl]phenyl]methanol (PubChem CID 59172726) has the molecular formula C18H11Cl6N3O and a molecular weight of 498.02 g/mol. Its IUPAC name is [4-[4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]phenyl]phenyl]methanol.
| Compound Name | [4-[4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]phenyl]phenyl]methanol |
|---|---|
| PubChem CID | 59172726 |
| Molecular Formula | C18H11Cl6N3O |
| Molecular Weight | 498.02 g/mol |
| Exact Mass | 494.90 |
| IUPAC Name | [4-[4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]phenyl]phenyl]methanol |
| SMILES | OCc1ccc(-c2ccc(-c3nc(C(Cl)(Cl)Cl)nc(C(Cl)(Cl)Cl)n3)cc2)cc1 |
| InChI | InChI=1S/C18H11Cl6N3O/c19-17(20,21)15-25-14(26-16(27-15)18(22,23)24)13-7-5-12(6-8-13)11-3-1-10(9-28)2-4-11/h1-8,28H,9H2 |
| InChIKey | ZFSSFUYBYWZURX-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 58.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.02 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|