C12H7Cl6N3O — CID 59172733
[4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]phenyl]methanol (PubChem CID 59172733) has the molecular formula C12H7Cl6N3O and a molecular weight of 421.93 g/mol. Its IUPAC name is [4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]phenyl]methanol.
| Compound Name | [4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]phenyl]methanol |
|---|---|
| PubChem CID | 59172733 |
| Molecular Formula | C12H7Cl6N3O |
| Molecular Weight | 421.93 g/mol |
| Exact Mass | 418.87 |
| IUPAC Name | [4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]phenyl]methanol |
| SMILES | OCc1ccc(-c2nc(C(Cl)(Cl)Cl)nc(C(Cl)(Cl)Cl)n2)cc1 |
| InChI | InChI=1S/C12H7Cl6N3O/c13-11(14,15)9-19-8(20-10(21-9)12(16,17)18)7-3-1-6(5-22)2-4-7/h1-4,22H,5H2 |
| InChIKey | CVWOAKOJJGJTGQ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 58.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.93 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|