C14H8Cl7N3O — CID 59172737
[4-[2-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]ethenyl]-2-chlorophenyl]methanol (PubChem CID 59172737) has the molecular formula C14H8Cl7N3O and a molecular weight of 482.41 g/mol. Its IUPAC name is [4-[2-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]ethenyl]-2-chlorophenyl]methanol.
| Compound Name | [4-[2-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]ethenyl]-2-chlorophenyl]methanol |
|---|---|
| PubChem CID | 59172737 |
| Molecular Formula | C14H8Cl7N3O |
| Molecular Weight | 482.41 g/mol |
| Exact Mass | 478.85 |
| IUPAC Name | [4-[2-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]ethenyl]-2-chlorophenyl]methanol |
| SMILES | OCc1ccc(C=Cc2nc(C(Cl)(Cl)Cl)nc(C(Cl)(Cl)Cl)n2)cc1Cl |
| InChI | InChI=1S/C14H8Cl7N3O/c15-9-5-7(1-3-8(9)6-25)2-4-10-22-11(13(16,17)18)24-12(23-10)14(19,20)21/h1-5,25H,6H2 |
| InChIKey | QCTBNOCVABUYGM-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 58.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.41 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|