About (4S)-4-(2-methoxyethyl)-4,5-dihydro-1,3-oxazol-2-amine
(4S)-4-(2-methoxyethyl)-4,5-dihydro-1,3-oxazol-2-amine (PubChem CID 59173124) has the molecular formula C6H12N2O2
and a molecular weight of 144.17 g/mol. Its IUPAC name is (4S)-4-(2-methoxyethyl)-4,5-dihydro-1,3-oxazol-2-amine.
Molecular Properties
| Compound Name | (4S)-4-(2-methoxyethyl)-4,5-dihydro-1,3-oxazol-2-amine |
| PubChem CID | 59173124 |
| Molecular Formula | C6H12N2O2 |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.09 |
| IUPAC Name | (4S)-4-(2-methoxyethyl)-4,5-dihydro-1,3-oxazol-2-amine |
| SMILES | COCC[C@H]1COC(N)=N1 |
| InChI | InChI=1S/C6H12N2O2/c1-9-3-2-5-4-10-6(7)8-5/h5H,2-4H2,1H3,(H2,7,8)/t5-/m0/s1 |
| InChIKey | YMOUXNOXRSWYJI-YFKPBYRVSA-N |
| XLogP | -0.26 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4S)-4-(2-methoxyethyl)-4,5-dihydro-1,3-oxazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-4-(2-methoxyethyl)-4,5-dihydro-1,3-oxazol-2-amine?
The IUPAC name of (4S)-4-(2-methoxyethyl)-4,5-dihydro-1,3-oxazol-2-amine (CID 59173124) is (4S)-4-(2-methoxyethyl)-4,5-dihydro-1,3-oxazol-2-amine.
What is the SMILES notation for (4S)-4-(2-methoxyethyl)-4,5-dihydro-1,3-oxazol-2-amine?
The canonical SMILES for (4S)-4-(2-methoxyethyl)-4,5-dihydro-1,3-oxazol-2-amine is COCC[C@H]1COC(N)=N1.
What is the InChIKey of (4S)-4-(2-methoxyethyl)-4,5-dihydro-1,3-oxazol-2-amine?
The InChIKey is YMOUXNOXRSWYJI-YFKPBYRVSA-N. The full InChI is InChI=1S/C6H12N2O2/c1-9-3-2-5-4-10-6(7)8-5/h5H,2-4H2,1H3,(H2,7,8)/t5-/m0/s1.
What are the key properties of (4S)-4-(2-methoxyethyl)-4,5-dihydro-1,3-oxazol-2-amine?
(4S)-4-(2-methoxyethyl)-4,5-dihydro-1,3-oxazol-2-amine has a molecular weight of 144.17 g/mol, XLogP of -0.26, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-4-(2-methoxyethyl)-4,5-dihydro-1,3-oxazol-2-amine is sourced from PubChem (CID 59173124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).