About (4S)-4-ethyl-4,5-dihydro-1,3-oxazol-2-amine
(4S)-4-ethyl-4,5-dihydro-1,3-oxazol-2-amine (PubChem CID 59173126) has the molecular formula C5H10N2O
and a molecular weight of 114.15 g/mol. Its IUPAC name is (4S)-4-ethyl-4,5-dihydro-1,3-oxazol-2-amine.
Molecular Properties
| Compound Name | (4S)-4-ethyl-4,5-dihydro-1,3-oxazol-2-amine |
| PubChem CID | 59173126 |
| Molecular Formula | C5H10N2O |
| Molecular Weight | 114.15 g/mol |
| Exact Mass | 114.08 |
| IUPAC Name | (4S)-4-ethyl-4,5-dihydro-1,3-oxazol-2-amine |
| SMILES | CC[C@H]1COC(N)=N1 |
| InChI | InChI=1S/C5H10N2O/c1-2-4-3-8-5(6)7-4/h4H,2-3H2,1H3,(H2,6,7)/t4-/m0/s1 |
| InChIKey | JTEWXLMHFCOPAX-BYPYZUCNSA-N |
| XLogP | 0.11 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.15 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4S)-4-ethyl-4,5-dihydro-1,3-oxazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-4-ethyl-4,5-dihydro-1,3-oxazol-2-amine?
The IUPAC name of (4S)-4-ethyl-4,5-dihydro-1,3-oxazol-2-amine (CID 59173126) is (4S)-4-ethyl-4,5-dihydro-1,3-oxazol-2-amine.
What is the SMILES notation for (4S)-4-ethyl-4,5-dihydro-1,3-oxazol-2-amine?
The canonical SMILES for (4S)-4-ethyl-4,5-dihydro-1,3-oxazol-2-amine is CC[C@H]1COC(N)=N1.
What is the InChIKey of (4S)-4-ethyl-4,5-dihydro-1,3-oxazol-2-amine?
The InChIKey is JTEWXLMHFCOPAX-BYPYZUCNSA-N. The full InChI is InChI=1S/C5H10N2O/c1-2-4-3-8-5(6)7-4/h4H,2-3H2,1H3,(H2,6,7)/t4-/m0/s1.
What are the key properties of (4S)-4-ethyl-4,5-dihydro-1,3-oxazol-2-amine?
(4S)-4-ethyl-4,5-dihydro-1,3-oxazol-2-amine has a molecular weight of 114.15 g/mol, XLogP of 0.11, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-4-ethyl-4,5-dihydro-1,3-oxazol-2-amine is sourced from PubChem (CID 59173126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).