C24H22ClN3O3S — CID 59174237
4-[3-[(4-chloro-2,5-dimethylphenyl)sulfonylamino]phenyl]-N-(cyanomethyl)-2-methylbenzamide (PubChem CID 59174237) has the molecular formula C24H22ClN3O3S and a molecular weight of 467.98 g/mol. Its IUPAC name is 4-[3-[(4-chloro-2,5-dimethylphenyl)sulfonylamino]phenyl]-N-(cyanomethyl)-2-methylbenzamide.
| Compound Name | 4-[3-[(4-chloro-2,5-dimethylphenyl)sulfonylamino]phenyl]-N-(cyanomethyl)-2-methylbenzamide |
|---|---|
| PubChem CID | 59174237 |
| Molecular Formula | C24H22ClN3O3S |
| Molecular Weight | 467.98 g/mol |
| Exact Mass | 467.11 |
| IUPAC Name | 4-[3-[(4-chloro-2,5-dimethylphenyl)sulfonylamino]phenyl]-N-(cyanomethyl)-2-methylbenzamide |
| SMILES | Cc1cc(S(=O)(=O)Nc2cccc(-c3ccc(C(=O)NCC#N)c(C)c3)c2)c(C)cc1Cl |
| InChI | InChI=1S/C24H22ClN3O3S/c1-15-11-19(7-8-21(15)24(29)27-10-9-26)18-5-4-6-20(14-18)28-32(30,31)23-13-16(2)22(25)12-17(23)3/h4-8,11-14,28H,10H2,1-3H3,(H,27,29) |
| InChIKey | NTRIFUXRQZXKCH-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 99.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.98 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|