C21H18FN5O3 — CID 59174325
N-[3-[[2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-5-fluoropyrimidin-4-yl]amino]phenyl]prop-2-enamide (PubChem CID 59174325) has the molecular formula C21H18FN5O3 and a molecular weight of 407.41 g/mol. Its IUPAC name is N-[3-[[2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-5-fluoropyrimidin-4-yl]amino]phenyl]prop-2-enamide.
| Compound Name | N-[3-[[2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-5-fluoropyrimidin-4-yl]amino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 59174325 |
| Molecular Formula | C21H18FN5O3 |
| Molecular Weight | 407.41 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | N-[3-[[2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-5-fluoropyrimidin-4-yl]amino]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(Nc2nc(Nc3ccc4c(c3)OCCO4)ncc2F)c1 |
| InChI | InChI=1S/C21H18FN5O3/c1-2-19(28)24-13-4-3-5-14(10-13)25-20-16(22)12-23-21(27-20)26-15-6-7-17-18(11-15)30-9-8-29-17/h2-7,10-12H,1,8-9H2,(H,24,28)(H2,23,25,26,27) |
| InChIKey | CNOAVCCNAVGCOM-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 97.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.41 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|