C32H42F2N6O6Si — CID 59174608
tert-butyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[[2-fluoro-4-[[5-fluoro-4-(3-nitroanilino)pyrimidin-2-yl]amino]phenoxy]methyl]pyrrolidine-1-carboxylate (PubChem CID 59174608) has the molecular formula C32H42F2N6O6Si and a molecular weight of 672.81 g/mol. Its IUPAC name is tert-butyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[[2-fluoro-4-[[5-fluoro-4-(3-nitroanilino)pyrimidin-2-yl]amino]phenoxy]methyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[[2-fluoro-4-[[5-fluoro-4-(3-nitroanilino)pyrimidin-2-yl]amino]phenoxy]methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 59174608 |
| Molecular Formula | C32H42F2N6O6Si |
| Molecular Weight | 672.81 g/mol |
| Exact Mass | 672.29 |
| IUPAC Name | tert-butyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[[2-fluoro-4-[[5-fluoro-4-(3-nitroanilino)pyrimidin-2-yl]amino]phenoxy]methyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](O[Si](C)(C)C(C)(C)C)C[C@H]1COc1ccc(Nc2ncc(F)c(Nc3cccc([N+](=O)[O-])c3)n2)cc1F |
| InChI | InChI=1S/C32H42F2N6O6Si/c1-31(2,3)45-30(41)39-18-24(46-47(7,8)32(4,5)6)16-23(39)19-44-27-13-12-21(15-25(27)33)37-29-35-17-26(34)28(38-29)36-20-10-9-11-22(14-20)40(42)43/h9-15,17,23-24H,16,18-19H2,1-8H3,(H2,35,36,37,38)/t23-,24+/m0/s1 |
| InChIKey | VJRIHNORQAVWGB-BJKOFHAPSA-N |
| XLogP | 7.93 |
| TPSA | 140.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.81 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|